Y’all Someone plz help me with these problems.

Girl I will report if u troll or link

Yall Someone Plz Help Me With These Problems.Girl I Will Report If U Troll Or Link

Answers

Answer 1

Answer:

A. 650 moles of sulphur.

B. 30 g of FeS₂

Explanation:

The balanced equation for the reaction is given below:

Fe + 2S —> FeS₂

From the balanced equation above,

1 mole of Fe reacted with 2 moles of S to produce 1 mole of FeS₂.

A. Determination of the mole of sulphur needed for the reaction.

From the balanced equation above,

2 moles of S reacted to produce 1 mole of FeS₂.

Therefore, Xmol of S will react to produce 325 moles of FeS₂ i.e

Xmol of S = 2 × 325

Xmol of S = 650 moles

Thus, 650 moles of sulphur are needed for the reaction.

B. Determination of the mass of FeS₂ produced by the reaction of 0.5 mole of sulphur.

From the balanced equation above,

2 moles of S reacted to produce 1 mole of FeS₂.

Therefore, 0.5 mole of S will react to produce = (0.5 × 1)/2 = 0.25 mole of FeS₂.

Finally, we shall determine the mass of 0.25 mole of FeS₂. This can be obtained as follow:

Mole of FeS₂ = 0.25 mole

Molar mass of FeS₂ = 56 + (32×2)

= 56 + 64

= 120 g/mol

Mass of FeS₂ =?

Mass = mole × molar mass

Mass of FeS₂ = 0.25 × 120

Mass of FeS₂ = 30 g

Thus, 30 g of FeS₂ were obtained from the reaction.


Related Questions

Krupton (Kr) is a

A. Gas
B. Metal
C. Non of these
D. Metalloid​

Answers

B is gas


The chemical element krypton is classed as a noble gas and a nonmetal.







Love you

Answer: C. None of these

Explanation: Krypton is a noble gas, on the right side of the period table, making it a non-metal.

What is a reducing agent?​

Answers

Answer: Its an element or compound that loses (or "donates") an electron to an electron recipient (oxidizing agent) in a redox chemical reaction.

CREDIT: Wikipedia

Answer:A reducing agent typically is in one of its lower possible oxidation states and is known as the electron donor.

Example: Examples of reducing agents include the earth metals, formic acid, oxalic acid, and sulfite compounds.

Read the temp what is it?

Answers

About 2.4 because there are 9 lines between the numbers

If you wanted to completely react 150 grams of FeBry, how many moles of sulfuric acid (H,SO) will you need to use?​

Answers

Answer:

Sulfuric acid, spent appears as a black oily liquid. Corrosive to metals and tissue. Density 15 lb /gal.

Explanation:

Do you think it is a good idea for all scientists to use the same periodic table of elements? Why or why not?

Answers

Yes because what other else can a scientist have

help me please Iknow it's easy but I need answers asap ​

Answers

Answer:

1-if u are answering light waves question , then the answer is translucent mirror or objects

2- Oxygen

3- compass

do weight loss Subliminals work?

Answers

Answer:

Some early research suggests that subliminal messages may influence food- and diet-related thoughts and behaviors. However, other research has found that subliminal messages with weight loss cues have no effect.

Explanation:

1 How do I make a girl blush?
2 How do I know if I girl might like me by looking at her body language?

Answers

Answer:

1. Make Her Smile with You. Your smile is something which can turn the tables for you, if you possess a nice smile then it is no doubt a plus point for you or flirt with her.

2. She tilts her head while looking at you.

She constantly 'fixes' her hair, makeup, or clothing.

She returns your physical touches.

She stares or looks over at you a lot.

She blushes around you.

Explanation:

you have a square with a Perimeter of 16 in,, what is the Area of the square after scaling it by 5?​
inches

Answers

Answer:

f the figure is a square with a perimeter of 16 inches, then each side of the square is 4 inchest in length. Area is found by multiplying the length x the width. For a square, the length and width are the same. A = 16 sq

Explanation:

Write a net ionic equation for the reaction that occurs when aqueous solutions of nitric acid and sodium hydroxide are combined.
Be sure to specify states such as (aq) or (s).

Answers

Answer:

H^+(aq) +  OH^-(aq) -------> H2O(l)

Explanation:

We must first write the molecular reaction equation as follows;

HNO3(aq) + NaOH(aq) ------>NaNO3(aq) + H2O(l)

The complete ionic equation is;

H^+(aq) + NO3^-(aq) + Na^+(aq) + OH^-(aq) -------> Na^+(aq) + NO3^-(aq) + H2O(l)

The net ionic equation therefore is;

H^+(aq) +  OH^-(aq) -------> H2O(l)

How many molecules are in 8.2 moles of water,H2o​

Answers

Answer:

4.938×10^24 molecules

Explanation:

a mole is 6.023×10^23

(8.2)×(6.023×10^23)=4.938×10^24

How many particles are in a 34 g sample of Al2(SO4)3?
please help!

Answers

Answer:

5.98 × 10^22 particles

Explanation:

To get the number of particles (nA) in a substance, we multiply the number of moles of the substance by Avogadro's number (6.02 × 10^23)

The mass of Al2(SO4)3 given in this question is as follows: 34grams.

To convert this mass value to moles, we use;

Mole = mass/molar mass

Molar Mass of Al2(SO4)3 = 27(2) + {(32 + 16(4) }3

= 54 + (32 + 64)3

= 54 + 288

= 342g/mol

mole (n) = 34/342

n = 0.0994mol

number of particles (nA) of Al2(SO4)3 = 0.0994 × 6.02 × 10^23

= 0.598 × 10^23

= 5.98 × 10^22 particles

What is the temperature

Answers

Answer:

I think it mught be 12.9?

Answer:

the average sum of kinetic energy of all the molecules present in a body is called temperature. it's 12.9

hope it is helpful to you

what are the Common compounds of niobium in which it is found

(include common names and their chemical formulas)

plssss help

Answers

Explanation:

Common Compounds of Niobium Nb

[Nb+3, Nb+5]

Compound NameFormulaMolar Mass

Niobium(III) OxideNb2O3233.811

Niobium(III) SulfateNb2(SO4)3474.0006

Niobium(V) PhosphateNb3(PO4)5753.576

Niobium(V) BromideNbBr5492.4264

Niobium(V) PentoxideNb2O5265.8098

Niobium OxychlorideNbOCl3215.2648

Niobium(V) IodideNbI5727.4287

Niobium(V) PentachlorideNbCl5270.1714

Niobium(V) ThiocyanateNb(SCN)5383.3184

Niobium(III) ChlorideNbCl3199.2654

Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259

Niobium NitrideNbN106.9131

Niobium(III) DichromateNb2(Cr2O7)3833.77676

Niobium HydroxideNb(OH)3143.9284

Niobium(V) PerchlorateNb(ClO4)5590.15938

Niobium(V) HypochloriteNb(ClO)5350.16838

Niobium(III) HypochloriteNb(ClO)3247.26358

Niobium(V) CarbonateNb2(CO3)5485.85726

Niobium(III) TartrateNb2(C4H4O6)3630.02564

Niobium(III) ChromateNb2(CrO4)3533.79386

Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356

6th grade science Major grade plz help ASAP

Answers

Answer: An organism is part of a community

____H3PO4 + ____ KOH --> ______K3PO4 + ____H2O can someone please balance that chemical equation?

Answers

Answer:

H3PO4 + 3KOH ----> K3PO4 + 3H2O

Explanation:

The valency of K element is + 1 while that of PO4 compound is -3

Hence, at least 3 K atoms are needed to combine with PO4 to form K3PO4 compound.

Hence, the revised equation will be

H3PO4 + 3KOH ----> K3PO4 + 3H2O

Now, the number of atoms and charges of each element is a given equation are equal on both the left and right hand side.

which system does the endocrine gland influence to fight infections

Answers

Answer:

Thymus. This gland makes white blood cells called T-lymphocytes that fight infection and are crucial as a child's immune system develops

A train with an initial velocity of 31 m/s begins accelerating at rate of 0.0705 m/s^2. If the train travels for 180.5s, how far does it travel?

Answers

Answer:

v = 43.72 m/s

Explanation:

Given that,

Initial velocity of the train, u = 31 m/s

Acceleration of the train, a = 0.0705 m/s²

Time for which the train travel, t = 180.5 s

We need to find the final velocity of the train. Let it is v.. Using first equation of kinematics to find it such that,

[tex]v=u+at\\\\v=31+0.0705\times 180.5\\\\v=43.72\ m/s[/tex]

So the final speed of the train is equal to 43.72m/s.

What type of circuit has a broken path that does NOT let current flow through it?
A : Closed circuit
B: Open circut
C : Toggle
D : Switch

Answers

Answer:

B

Explanation:

How are stoichiometric calculations performed for redox reactions?

Answers

Answer:

(b) Both Assertion and Reason are correct but Reason is not the correct explanation for Assertion

Explanation:

According to the law of conservation of mass, matter can neither be created nor be destroyed. However, it can be transformed from one form into another. During chemical reactions, atoms or ions are exchanged between reactants to form products. Thus, all the stoichiometric calculations are based on law of conservation of mass.

During redox reactions, one species is oxidized and other species is reduced. This involves electron transfer.

PLEASE HELP PLS PLS PLS
Methane, CH4(g), and oxygen gas, O2(g) react to produce carbon dioxide, CO2(g), and water H2O(g). What volume of methane is required to react with oxygen to produce 32.5 L of carbon dioxide? *
a) 65.0 L
b) 48.8 L
c) 16.3 L
d) 32.5 L

Answers

Answer:

D)

Explanation:

CH4 + 2O2 = CO2 + 2H2O

1 (L CO2)= 32.5(L CO2)

1 (CH4) = 32.5 (L CH4)

Using the human species as an example, explain why physical appearance or morphology is NOT always useful for identifying organisms belonging to the same species.

Answers

Answer:

Get SNS

Explanation:

number 1 ............​

Answers

Answer:

I am guessing it is B. Non-metal, metals, metalloids

B. Metals, Non-Metals, Metalloids



Metals: located in the South and West of Periodic Table. Tend to give up electrons (form cations) and form simple ionic compounds with non-metal anions. Most of the 118 known elements are metals.


2. Non-Metals : located in the North and East of the Periodic Table. Tend to attract electrons (form anions) and combine with metal cations to make ionics, or share them with other non-metals and form covalent compounds . There are nineteen nonmetals, if we consider the ‘latest” two, which are not well characterized and have fleeting lifetimes.


3. Metalloids: straddle a staircase-like region between metals and non-metals. Their properties are intermediate between metals and non metals (in varying proportions). There are only seven metalloids.


So the answer is B ❤️

how atoms form chemical bond discuss in detail

Answers

Answer:

Atoms form chemical bonds to make their outer electron shells more stable. An ionic bond, where one atom essentially donates an electron to another, forms when one atom becomes stable by losing its outer electrons and the other atoms become stable (usually by filling its valence shell) by gaining the electrons.

How does Gibbs free energy predict spontaneity?
O A. If AG > 0, the reactigais spontaneous.
B. If AG = 0, the reaction is spontaneous.
C. If AG < 0, the reaction is spontaneous.
O D. If AG = TAS, the reaction is spontaneous.

Answers

Answer:

C

Explanation:

plz mark brainliest

Gibbs free energy predict spontaneity if G < 0, the reaction is spontaneous and the correct statement is option C.

What is Gibbs Free Energy?

Gibbs free energy is a quantity that is used to measure the maximum amount of work done in a thermodynamic system when the temperature and pressure are kept constant.

Gibbs free energy is denoted by the symbol ‘G’. Its value is usually expressed in Joules or Kilojoules.

Gibbs free energy can be defined as the maximum amount of work that can be extracted from a closed system.

Gibbs free energy to determine the spontaneity of a process.

Therefore, Gibbs free energy predict spontaneity if G < 0, the reaction is spontaneous and the correct statement is option C.

Learn more about Gibbs free energy, here:

https://brainly.com/question/20358734

#SPJ5

Question :What's oxidation?

Answers

Answer:

The process or result of oxidizing or being oxidized.(Rust)

Explanation:

Pluto

9. Circle the atom in each pair that has the greater ionization energy.

A) Li or Be
B) Ca or Ba
C) Na or K
D) P or Ar
E) Cl or Si
F) Li or K

Answers

A: BE has more ionization energy than LI

B: CA has more ionization energy than BA.
C: NA has more ionization energy than K

D: AR has more ionization energy than P

E: CI has a more ionization energy than SI
F: LI has more ionization energy than K


If any of these are wrong feel free to correct me in the comments.

A) Be

B) Ca

C) Na

D) Ar

E) Cl

F)  Li

This question simply deals with ionization energy trends across the periodic table or down the group.

Ionization energy is the energy that is needed to remove an electron from its orbital around an atom in such a manner that it will no longer be associated with that same atom.

Now, from studies, it has been found that Ionization energy decreases down a group but it tends to increase as we go from the left to right going across the periodic table.

A) Li(Lithium) and Be(Berrylium) belong to the same period which is period 2 on the periodic table. Berrylium comes after berrylium in that period and as such from the rule earlier, berrylium will have the greater ionization energy.

B) Ca(Calcium) and Ba(Barium) belong to the same group 2 in the periodic table with barium further down the group. Thus, from the trend, Ca(Calcium) will have the greater ionization energy.

C) Na(Sodium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend, Na(Sodium) will have the greater ionization energy.

D) P(Phosphorus) and Ar(Argon) belong to the same period which is period 3 on the periodic table. Argon comes after Phosphorus in that period and as such from the rule earlier, argon will have the greater ionization energy.

E) Cl(Chlorine) and Si(Silicon) belong to the same period which is period 3 on the periodic table. Cl(Chlorine) comes after Si(Silicon) in that period and as such from the rule earlier, Cl(Chlorine) will have the greater ionization energy.

F) Li(Lithium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend,  Li(Lithium) will have the greater ionization energy.

Read more at: brainly.in/question/13610645

Can somebody help me pls pls pls pls pls

Answers

Answer:

1.5e + 24 I think, hope this can help

How many milliliters of 0.20 M NaOH must be added to 75 mL of 0.050 M HCl to make a neutral solution?

Answers

Answer:

this should help

Explanation:

2 . how many moles are present in a 12.65g of potassium(k)?​

Answers

Answer:

0.324 mol

Explanation:

Mass of one mole or atomic mass of potassium is 39 g. Thus, number of moles in 12.65 g of potassium is 0.32 moles.

What is atomic mass?

Atomic mass of an element is the mass of one mole of that element. One mole of an element contains 6.022 × 10²³ atoms. This  number is called Avogadro number.

Potassium is 19th element n periodic table. It is an alkali metal in the first group. The atomic mass of potassium is 39 g/mol. This is the mass of one mole of potassium. The chemical symbol of potassium is K.

Given  mass of potassium = 12.65 g

atomic mass = 39 g/mol

number of moles in 12.65 g = mass/ atomic mass

no.of moles  = 12.65 /39 = 0.32 moles.

Therefore, the number of moles of 12.65 g of potassium is 0.32 moles.

Find more on atomic mass:

https://brainly.com/question/17067547

#SPJ2

Other Questions
help please i need it asap Please Help ASAP!!!!!!!! vProblem 10-4 Partnership Formation (LO 10.2) Elaine's original basis in the Hornbeam Partnership was $40,000. Her share of the taxable income from the partnership since she purchased the interest has been $70,000, and Elaine has received $80,000 in cash distributions from the partnership. Elaine did not recognize any gains as a result of the distributions. In the current year, Hornbeam also allocated $1,000 of tax-exempt interest to Elaine. Calculate Elaine's current basis in her partnership interest. $fill in the blank 1 Which natural formation blocked China's expansion into Mongolia? Please answer both of you can 8.2.AP-7BFind the measure of side c.a = 26 mCC=m (Round the answer to the nearest whole number.) Please I need this will mark brainliest THIS IS DUE NOW wiil give crown if right Winston bought an encyclopedia priced at $42. Shipping and handling cost anadditional 30% of the price. What was the total cost of the encyclopedia, in cluding shipping and handling? The purpose of mitosis is to ___, while the purpose of meiosis is to ____. a) make new cells, and only germ-line cells do it; b) make eggs or sperm, and all the body cells do it make eggs or sperm, and only germ-line cells do it; c) make new cells, and all body cells do it make eggs or sperm, and only somatic cells do it; d) make new cells, and all body cells do it make new cells, and all body cells do it; e) make eggs or sperm, and only germ-line cells do it What is the sum of the interior angles of a 15-gon? Look at the graphic organizer.What belongs in the empty box? A. He meditates under a tree for many hours. B. He uses his wealth to end human suffering. C. He marries a princess and lives in a palace. D. He leaves his home to look for answers. How does plot impact the effectiveness of a novel? Write the meaning of the following word. abbreviate how names and zodiacs affect who people are and how they look In 2002, the average price of a new domestic car was $19,126. In 2008, the average price was $28,715. Based on a linear model, what is the predicted average price for 2014? Ston Down What is the bias in the story of "A Prejudiced Mind". What is the main reason the 1920s are known as the "Roaring Twenties?(0.5 Points)A. most people were able to buy carsB. jazz music became popularC. women were given more rightsForgivenD. it was a time of prosperity and cultural change If you could completely remove something you put online forever, what would it be? farmers are more important than doctors What was your favorite piece of art by Salvador Dali?