30 POINTS!!
2/5v = 4

v = 10
True or False?

30 POINTS!!2/5v = 4v = 10True Or False?

Answers

Answer 1

Answer:

its true

Step-by-step explanation:

[tex]\frac{2}{5} * \frac{10}{1}=\frac{20}{5}[/tex]
[tex]\frac{20}{5} = \frac{4}{1} = 4[/tex]

have a good day.

Answer 2

Answer:

True.

Step-by-step explanation:

Note the equal sign, what you do to one side, you do to the other. Multiply the reciprocal of the fraction to both sides to isolate the variable, v.

The reciprocal in math is described as the quantity that is multiplied that will result in 1. In this case, you will multiply 5/2 to both sides of the equation:

[tex]\frac{2}{5}v = 4\\ \\(\frac{5}{2})\frac{2}{5}v = 4 * (\frac{5}{2})\\[/tex]

[tex]v = \frac{4 * 5}{2} = \frac{20}{2} = 10\\ v = 10[/tex] (True).

In this case, v = 10 will work to solve the given equation, and so it is true.

~


Related Questions

Also 5 3/7 x 3 1/2 Thanks

Answers

Answer: 19

5 3/7 to an improper fraction is = 38/7
3 1/2 to an improper fraction is = 7/2

38x7 = 266
7x2 = 14

266/14 = 19

Laura is building a fence around a circular pond. The pond has a diameter of 30 feet. What is the minimum amount of fencing Laura will need?

Answers

Answer:

Step-by-step explanation:

Minimum Amount = circumference of the pond.

Formulas

C = pi * d

Givens

pi = 3.14

d = 30 feet

Solution

C = pi*d             Substitute for the givens.

C = 3.14 * 30      Multiply

C =  94.2

tell me how to decompose 792

Answers

Answer:

break it down to prime factorization

so the ans will be 2^3 * 3^2 *11

A triangle has two sides of length 17 and 2. What is the smallest possible whole-number length for the third side?

Answers

Answer: 16

Step-by-step explanation:

Please please help me please

Answers

Answer:

A

Step-by-step explanation:

It could just be it was dilated (I think thats the word) by 3. 6×3=18, 8×3=24

Find the measurement of angle ( A ) round to the nearest hundred

Answers

Answer:

all you have to do is round to the nearest.

Step-by-step explanation:

just do it .

PLEASE HELP FAST URGENT!!!

Answers

Answer:

A= Origen C= q1 B=Q2

Step-by-step explanation

your left-hand side is quadrant TWO Your top right-hand corner is Quadrant ONE and your second to the last one is left-hand side down Is Quadrant THREE last but not least is Quadrant FOUR. And the zero in the middle means ORIGEN.

Find the midpoint of the line segment with end coordinates of:
(

3
,

1
)
and
(
4
,

5
)

Give coordinates as decimals where appropriate.

Answers

Answer:

(0.5, -3)

Step-by-step explanation:

(-3, -1) (4, -5)

midpoint formula

(x1 + x2) /2, (y1 + y2) /2

-3 + 4 = 1 / 2 = 0.5

-1 + -5 = -6 / 2 = -3

PLEASE HELP ME ITS URGENT!!!!


A rectangular garden has a walkway around it. The area of the garden is 4(5.5x + 1.5). The combined
area of the garden and the walkway is 4.5(8x + 4). Find the area of the walkway around the garden as
the sum of two terms.
CD
The area of the walkway around the garden is 1
(Simplify your answer. Use integers or decimals for any numbers in the expression.)

Answers

Solving the Question

We're given:

Area (garden) = 4(5.5x + 1.5)Area (garden + walkway) = 4.5(8x + 4)

To find the area of the garden alone, we can subtract the area of the garden from the combined area of the garden and walkway:

[tex]4.5(8x + 4)-4(5.5x + 1.5)[/tex]

Open up the parentheses:

[tex]= 36x +18 -22x - 6[/tex]

Combine like terms:

[tex]= 36x +18 -22x - 6\\= 14x +18 - 6\\= 14x +12[/tex]

Answer

The area of the walkway around the garden is 14x + 12.

Colin is c years old. His 14 year old sister, Katie, is 4 years younger than Colin. write an expression

Answers

Answer: C - 4 = 14

Step-by-step explanation: In the expression, "c" is colin's age so, if you subtract 4 years for his age, you get Katie's age, which is 14.

What is the value of x? (5 points)

Answers

30 + 2x = 90
2x = 60
x = 30

Answer:
x = 30

The weight that a horizontal beam can support varies inversely as the length of the beam. Suppose that a 2-m beam can support 310 kg. How many kilograms can a 10-m beam support? a. 0. 0161 kg b. 62 kg c. 15. 5 kg d. 0. 0645 kg.

Answers

A beam of length 10m can support a weight of 62kg.

It is given that

Weight W ∝ 1/ Length L

W ∝ 1/L

W = k/L...........eq1

where k is constant of proportionality

What is the constant of proportionality?

The constant of proportionality is the ratio that relates two given values.

It is given that when L= 2m, W = 310kg

310 = k/2

k = 620

So put the k value in eq1,

eq1 becomes,

W = 620/L

when L = 10

W = 620/10

W =62kg

Therefore, a beam of length 10m can support a weight of 62kg.

To get more about the constant of proportionality visit:

https://brainly.com/question/26171814

i need help asap pls

Answers

Step-by-step explanation:

[tex]m + 148 = 3m + 10[/tex]

[tex]148 - 10 = 3m - m[/tex]

therefore

3m = 138

m = 138/3

m = 46°

pls give brainliest

Shelley drew a scale drawing of the high school. She used the scale 5 millimeters: 3 meters.
If the actual width of the parking lot is 42 meters, how wide is the parking lot in the drawing?

Answers

Answer:

70 meters

Step-by-step explanation:

Based on the given conditions, formulate:: 45x5/3

Cross out the common factor: 14x5

Calculate the product or quotient: 70

The width of the parking lot in the drawing is, 70 milliliters.

What is Multiplication?

To multiply means to add a number to itself a particular number of times. Multiplication can be viewed as a process of repeated addition.

Given that;

She used the scale 5 millimeters: 3 meters.

And, The actual width of the parking lot is 42 meters.

Hence, We can formulate;

The width of the parking lot in the drawing = 42 × 5 / 3

                                                                  = 70 milliliters

Learn more about the multiplication visit:

https://brainly.com/question/10873737

#SPJ2

PLEASE HELP ANSWER THESE FAST, will give brainliest and 100 points

Answers

Step-by-step explanation:

11.

x is sin(60) in a circle with radius of 8.

x = sin(60)×8 = 6.92820323... ≈ 6.9

12.

x is sin(30) in a circle with radius "diagonal length".

6 is cos(30) in the same circle.

6 = cos(30)×r

r = 6/cos(30) = 6.92820323...

x = sin(30)×r = 3.464101615... ≈ 3.5

13.

similar to 12.

but we refer to the angle at the bottom right vertex.

remember, the sum of all angles in a triangle is always 180°.

so, the angle over there at the right is

180 - 90 - 68 = 22°

x = sin(22)×r

25 = cos(22)×r

r = 25/cos(22) = 26.96336857...

x = sin(22)×r = 10.10065565... ≈ 10.1

14.

9 is the sine of the complementary angle of 49 in a circle with radius x.

the complementary angle is the angle that adds up with the original angle to 90° and is therefore

90 - 49 = 41°

9 = sin(41)×x

x = 9/sin(41) = 13.71827778... ≈ 13.7

18.

we use the extended Pythagoras :

c² = a² + b² - 2ab×cos(C)

with c being the side opposite of the angle C.

so we have

LK² = 16² + 24² - 2×16×24×cos(29) =

= 256 + 576 - 768×cos(29) =

= 832 - 671.7079351... = 160.2920649...

LK = 12.66065026... ≈ 12.7

19.

law of sine

a/sin(A) = b/sin(B) = c/sin(C)

with the sides being always opposite to the corresponding angles.

to find the angle at H we need to find the angle at G first, because we don't know GF yet.

so,

28/sin(76) = 18/sin(G)

sin(G) = 18×sin(76)/28 = 0.623761538...

G = 38.59134528...°

remember the 180° rule in triangles.

H = 180 - 76 - G = 65.40865472...° ≈ 65.4°

20.

GF is now calculated using the law of sine again.

28/sin(76) = GF/sin(H)

GF = 28×sin(H)/sin(76) = 26.23980579... ≈ 26.2

Let x, y, and z represent three rational numbers, such that y is 512 times x and z is 50.25 more than x. If y=15.5, what is the value of z?

Answers

The value of z is equal to 50.28.

System of Linear Equations

System of linear equations is the given term math for two or more equations with the same variables. The solution of these equations represents the point at which the lines intersect.

Rational Numbers

These numbers are represented by a ratio between two integers numbers ([tex]\frac{a}{b}[/tex]), where b[tex]\neq[/tex]0.  Besides, this ratio can be simplified in decimal form.

For solving this equation, firstly, rewrite the information given:

                                          [tex]y=512x \;(1)\\ \\ z=50.25+x \;(2)\\ \\ y=15.5 \;(3)[/tex]

As the question gives the values for y, you can find x.

                                        [tex]y=512x\\ \\ 15.5=512x\\ \\ x=\frac{15.5}{512} =0.03[/tex]

Applying x=0.03 in the equation (3), you can find z.

                              [tex]z=50.25+x \\ \\ z=50.25+0.03\\ \\ z=50.28[/tex]

Learn more about the system of equations here:

https://brainly.com/question/384631

look at the attachment
Simplified it too
pls take it seriously ​

Answers

[tex]\\ \rm\rightarrowtail \dfrac{sin(180+A)+2cos(180+A).cos(A-180)}{2cos^2(360+A)-cos(-A)}[/tex]

[tex]\\ \rm\rightarrowtail \dfrac{-sinA+2(cos^2A-sin^2A)}{2cos^2A-cosA}[/tex]

[tex]\\ \rm\rightarrowtail \dfrac{-sinA+2cos^2A-2sin^2A}{cosA(2cosA-1)}[/tex]

[tex]\\ \rm\rightarrowtail \dfrac{-sinA+2-2sin^2A-2sin^2A}{cosA(2cosA-1)}[/tex]

[tex]\\ \rm\rightarrowtail \dfrac{-sinA-4sin^2A}{cosA(2cosA-1)}[/tex]

[tex]\\ \rm\rightarrowtail \dfrac{-sinA(4sinA-1)}{cosA(2cosA-1)}[/tex]

[tex]\\ \rm\rightarrowtail -tanA\left(\dfrac{4sinA-1}{2cosA-1}\right)[/tex]

The function f(x)= -45x + 270 represents the total distance, in miles, a traveler is from home x hours after beginning the trip home. What is the average rate of change over the interval from x = 1 to x = 3, in miles per hour?

Answers

[tex]\bold{\huge{\underline{ Solution }}}[/tex]

Given :-

We have given one function f(x) = -45x + 270 The given function represents the total distance in miles. The initial interval was x = 1 and final interval was x = 3

To Find :-

We have to find the rate of change over the given interval

Let's Begin :-

Here, We have

Function = f(x) = -45x + 270

The given function represents the total distance in miles covered by the traveller.

Therefore,

For initial interval that is x = 1 , Distance covered by the traveller

[tex]\sf{ f(x) = -45x + 270 }[/tex]

[tex]\sf{ f(1) = - 45(1) + 270 }[/tex]

[tex]\sf{ f(1) = - 45 + 270 }[/tex]

[tex]\sf{ f(1) = 225 }[/tex]

For final interval that is x = 3, Distance covered by the traveller

[tex]\sf{ f(x) = - 45x + 270 }[/tex]

[tex]\sf{ f(1) = - 45(3) + 270 }[/tex]

[tex]\sf{ f(1) = - 135 + 270 }[/tex]

Now,

We have to find the average rate of change over the given time interval

Therefore,

Average rate of change in the given time interval

[tex]\sf{ = }{\sf{\dfrac{ f(1) + f(3) }{3 - 1}}}[/tex]

[tex]\sf{ = }{\sf{\dfrac{ 225 + ( -135) }{ 2}}}[/tex]

[tex]\sf{ = }{\sf{\dfrac{ 225 - 135 }{ 2}}}[/tex]

[tex]\sf{ = }{\sf{\dfrac{ 90 }{ 2}}}[/tex]

[tex]\sf{ = 45 }[/tex]

Hence, The average rate of change over the given interval is 45 miles per hour.

After spending $6.75 on a meal and $1.25 on drinks, Maria had $12 left.
What percent of her money did Maria spend?

Answers

Answer:

40%

Step-by-step explanation:

6.75 + 1.25 = 8 (Total she just spent)

8 (Total she just spent) + 12 (Total she had left) = 20 (Total she started with)

8/20 = 0.4 = 40%

(Total spent / total she started with = 40%)

A rectangular prism has a length of 3 meters, a height of 7 meters, and a width of 7 meters. What is its volume, in cubic meters?​

Answers

Volume = length • height • width
= 3•7•7 = 147 cubic meters


A lil help would be nice

(Explained answer will get brainlyist)

Answers

Answer:

10 cm

Step-by-step explanation:

Out of that [tex]160 cm^2[/tex], part of it is given by the surface of the top and bottom faces, which have area [tex]2\times 5 cm^2 = 10 cm^2[/tex] each, for a total of [tex]20 cm^2[/tex] . We are then left with [tex]140 cm^2[/tex] of surface from the side area. That area you can imagine as a rectangle of height h (which we need to know) and base [tex]5+2+5+2 cm = 14 cm[/tex] (imagine it as a box opened on a flat surface)

At this point we have [tex]140cm^2 = 14 cm \times h \rightarrow h= 10 cm[/tex]

What decimal best represents 1/4

Answers

Answer:

.25

Step-by-step explanation:

.25 or 1/4 is one-fourth of 1

You can divide 1 by 4 to get .25

Determine is (x-3) is a factor of
x^3 - 5x^2 - 4x + 6 using the remainder
theorem:

Answers

Answer:

(x - 3) is not a factor

Step-by-step explanation:

If (x - h) is a factor of f(x) then f(h) = 0

here

f(x) = x³ - 5x² - 4x + 6 , then

f(3) = 3³ - 5(3)² - 4(3) + 6 = 27 - 5(9) - 12 + 6 = 27 - 45 - 6 = - 24

since f(x) ≠ 0 then (x - 3) is not a factor of f(x)

Ratio volume of 2 cylinders is 125:343

Answers

Answer:

5145cm²

125/343=1875/x

x=1875×343÷125=5145

Ms. Yang left work at 5:15 p.m. She
went to the gym for 90 minutes,
and then it took her 40 minutes to
drive home. What time did Ms. Yang
get home?

HELP ME PLEASE ( 5th grade math )

Answers

Ms. Yang got home at 7:25pm

Answer:

7:25

Step-by-step explanation:

Overall it took her 130 minutes while she was out so if you put that in time measurement it would be 7:25.

hey so im also looking for the first answer and the choices were “ is not “ and “ is “

Answers

so the investigator found the skid marks were 75 feet long hmmm what speed will that be?

[tex]s=\sqrt{30fd}~~ \begin{cases} f=\stackrel{friction}{factor}\\ d=\stackrel{skid}{feet}\\[-0.5em] \hrulefill\\ f=\stackrel{dry~day}{0.7}\\ d=75 \end{cases}\implies s=\sqrt{30(0.7)(75)}\implies s\approx 39.69~\frac{m}{h}[/tex]

nope, the analysis shows that Charlie was going faster than 35 m/h.

now, assuming Charlie was indeed going at 35 m/h, then his skid marks would have been

[tex]s=\sqrt{30fd}~~ \begin{cases} f=\stackrel{friction}{factor}\\ d=\stackrel{skid}{feet}\\[-0.5em] \hrulefill\\ f=\stackrel{dry~day}{0.7}\\ s=35 \end{cases}\implies 35=\sqrt{30(0.7)d} \\\\\\ 35^2=30(0.7)d\implies \cfrac{35^2}{30(0.7)}=d\implies 58~ft\approx d[/tex]

Which number line shows the solution of –5x + 10 > –15?

Answers

Answer:

B.

Step-by-step explanation:

-5x + 10 > -15

-5x + 10 - 10 > -15 - 10

-5x > -25

-5x / -5 > -25/(-5)

x < 5

1. If two angles of a triangle are equal and the third angle measures 110°, then find the measure of each angle ​

Answers

Answer:

35

Step-by-step explanation:

There are 3 angles in a triangle

∠1 , ∠2 , ∠3

Of which

∠1 = ∠2

∠3 = 110

By angle sum property

∠1 + ∠2 + ∠3 = 180

∠1 + ∠2 = 180-110

∠1 + ∠2 = 70

∠1 = 70 ÷ 2

=35

∠1 = ∠2 = 35

Hence , 35+35+110 = 180

Answer:

35°, 35°, 110°

Step-by-step explanation:

the sum of the 3 angles in a triangle = 180°

let the equal angles be x , then

x + x + 110 = 180 , that is

2x + 110 = 180 ( subtract 110 from both sides )

2x = 70 ( divide both sides by 2 )

x = 35

the measure of each angle is 35° , 35° , 110°

100!!! Points
Select the correct answer.
What is the range of the function shown in the graph?

Answers

See the line is parallel to x axis.The equation of that top is y<5

So

The range is

(-oo,0)U(oo,5)

So

-oo<y<5

Option D is correct

A model of a skyscraper is made using a scale of 1 inch: 75 feet. What is the height of the actual building if the height of the model is 19 2/5 inches?

Answers

4. If 8 ft = 1 in
Then 60 ft = 60 x 1/8 = 7.5 in
Length of model = 7.5 in
Scale factor = 1/8

5. If 4 m = 1 cm
Then 192 m = 192/4 x 1 = 48 cm
Length of model = 48 cm
Scale factor = 1/4

6. If 1.5 ft = 2 in
Then 13.5 ft = 13.5 x2/1.5 = 18 in
Length of model = 18 in
Scale factor = 2/1.5 =1.333

Skyscraper

Scale = 1 in : 75 ft
Height of model= 19 2/5in=19.4in

Height of actual building
19.4 x 75 = 1455 ft

Other Questions
Which option best describes synthesis? What is the value of x2 + 4 for x = 5? Please help question attached On January 2, 2021, Hernandez, Inc. signed a ten-year noncancelable lease for a heavy duty drill press. The lease stipulated annual payments of $300,000 starting at the beginning of the first year, with title passing to Hernandez at the expiration of the lease. Hernandez treated this transaction as a finance lease. The drill press has an estimated useful life of 15 years, with no salvage value. Hernandez uses straight-line depreciation for all of its plant assets. Aggregate lease payments were determined to have a present value of $1,800,000, based on implicit interest of 10%. In its 2021 income statement, what amount of interest expense should Hernandez report from this lease transaction Whats the answer??? I also need help on 12,13, and 14 I re read them but still dont understand how to do the math problem The boiling point of water at sea level is _____.A.dependent on the volume of waterB.212 degrees CelsiusC.105 degrees CelsiusD.100 degrees Celsiusplease help asap :( HELP!!![BWS.05]Where would positively charged particles be most likely found in an atom?O around the electronsO inside the electronsO inside the nucleusO outside the nucleus Solve the equation |X+2|+4 = 11O X= 5O no solutionO X=5,-9O X= 7, -11 Enzymes catalyze chemical reactions by lowering the:. Can someone pls help me? A fixed interest rates is generally a better option than a variable rate in whichsituation?A. A business owner is seeking a short-term loan to cover emergencyexpenses and expects to pay it off quickly. B. A married couple is seeking a 30-year mortgage for a house that they plan to live in for a long time. C. A contractor is seeking a mortgage on a home that he plans to "flip," or renovate to sell, within 18 months. D. A student is seeking a credit card to use for daily expenses and plans to pay off the balance each month. a square has a side length of 6 inches it is enlarged and the ew side length is 18 inches what is the scale factor? A 2. 0 kg ball is dropped from a rest 10m above the ground. How fast will the ball hit the ground What is the sum of the series 1830201054005490 Which of the following statements is true about Metabolism?Question 4 options:Your basal metabolism is the amount of energy (calories) your body uses just to keep you living.Your metabolism speeds up naturally as you get olderYou can never speed up or slow down your body's metabolismYour metabolism is not affected your heredity, age, and maturation What is the distance between (4, 3) and (7, 3)? What mass of iron (III) chloride contains 2.35 x [tex]10^{23}[/tex] chloride ions? GIVE BRAINLIEST TO BEST ANSWER AND HIGH POINT QUESTIONWhich statement is the best synthesis of information from these two sources?Source 1: Our economy benefits from the higher salaries people with college degrees earn.Source 2: College enrollment has been going down since 2012.A. The economy will suffer if the government doesn't address theissues that prevent people from enrolling in college.B. Colleges should do more to attract talented people and encouragethem to earn their degrees.C. The country should make sure that everyone who wants to go tocollege can attend without taking on too much debt.D. College graduates earn more than high school graduates evenafter college debt is considered. Refer to the attachment and please fill up the answers with conjunctionsFirst and Correct answer will be marked brainliest and spam will be reported.